C11H13Cl2N3O4S — CID 131855550
(2S)-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide (PubChem CID 131855550) has the molecular formula C11H13Cl2N3O4S and a molecular weight of 354.22 g/mol. Its IUPAC name is (2S)-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide.
| Compound Name | (2S)-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide |
|---|---|
| PubChem CID | 131855550 |
| Molecular Formula | C11H13Cl2N3O4S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | (2S)-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide |
| SMILES | NC(=O)CC[C@H](NS(=O)(=O)c1ccc(Cl)c(Cl)c1)C(N)=O |
| InChI | InChI=1S/C11H13Cl2N3O4S/c12-7-2-1-6(5-8(7)13)21(19,20)16-9(11(15)18)3-4-10(14)17/h1-2,5,9,16H,3-4H2,(H2,14,17)(H2,15,18)/t9-/m0/s1 |
| InChIKey | PAMIZEIOHDQHID-VIFPVBQESA-N |
| XLogP | 0.39 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |