C12H14Cl2N2O3S — CID 95776994
(3S)-3-cyclopropyl-3-[(3,4-dichlorophenyl)sulfonylamino]propanamide (PubChem CID 95776994) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is (3S)-3-cyclopropyl-3-[(3,4-dichlorophenyl)sulfonylamino]propanamide.
| Compound Name | (3S)-3-cyclopropyl-3-[(3,4-dichlorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 95776994 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (3S)-3-cyclopropyl-3-[(3,4-dichlorophenyl)sulfonylamino]propanamide |
| SMILES | NC(=O)C[C@H](NS(=O)(=O)c1ccc(Cl)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C12H14Cl2N2O3S/c13-9-4-3-8(5-10(9)14)20(18,19)16-11(6-12(15)17)7-1-2-7/h3-5,7,11,16H,1-2,6H2,(H2,15,17)/t11-/m0/s1 |
| InChIKey | QQIJDQNYMPAMSF-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |