C11H12Cl2NO4S2- — CID 2427322
(2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 2427322) has the molecular formula C11H12Cl2NO4S2- and a molecular weight of 357.26 g/mol. Its IUPAC name is (2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2427322 |
| Molecular Formula | C11H12Cl2NO4S2- |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | (2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccc(Cl)c(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C11H13Cl2NO4S2/c1-19-5-4-10(11(15)16)14-20(17,18)7-2-3-8(12)9(13)6-7/h2-3,6,10,14H,4-5H2,1H3,(H,15,16)/p-1/t10-/m0/s1 |
| InChIKey | PHIVQMNSQNDMDW-JTQLQIEISA-M |
| XLogP | 1.14 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |