C25H25Cl2N3O4S — CID 25197369
(2S)-N,N'-dibenzyl-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide (PubChem CID 25197369) has the molecular formula C25H25Cl2N3O4S and a molecular weight of 534.47 g/mol. Its IUPAC name is (2S)-N,N'-dibenzyl-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide.
| Compound Name | (2S)-N,N'-dibenzyl-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide |
|---|---|
| PubChem CID | 25197369 |
| Molecular Formula | C25H25Cl2N3O4S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | (2S)-N,N'-dibenzyl-2-[(3,4-dichlorophenyl)sulfonylamino]pentanediamide |
| SMILES | O=C(CC[C@H](NS(=O)(=O)c1ccc(Cl)c(Cl)c1)C(=O)NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C25H25Cl2N3O4S/c26-21-12-11-20(15-22(21)27)35(33,34)30-23(25(32)29-17-19-9-5-2-6-10-19)13-14-24(31)28-16-18-7-3-1-4-8-18/h1-12,15,23,30H,13-14,16-17H2,(H,28,31)(H,29,32)/t23-/m0/s1 |
| InChIKey | UEOJTDKWVNWAHF-QHCPKHFHSA-N |
| XLogP | 4.05 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |