C10H11BrClNO4S — CID 106605478
(2R)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]butanoic acid (PubChem CID 106605478) has the molecular formula C10H11BrClNO4S and a molecular weight of 356.63 g/mol. Its IUPAC name is (2R)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]butanoic acid.
| Compound Name | (2R)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 106605478 |
| Molecular Formula | C10H11BrClNO4S |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | (2R)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]butanoic acid |
| SMILES | CC[C@@H](NS(=O)(=O)c1ccc(Cl)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C10H11BrClNO4S/c1-2-9(10(14)15)13-18(16,17)6-3-4-8(12)7(11)5-6/h3-5,9,13H,2H2,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | FBINTUJRMZMHGF-SECBINFHSA-N |
| XLogP | 2.24 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |