C11H14ClNO6S2 — CID 43415212
2-[(2-chloro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid (PubChem CID 43415212) has the molecular formula C11H14ClNO6S2 and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-[(2-chloro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 2-[(2-chloro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43415212 |
| Molecular Formula | C11H14ClNO6S2 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-[(2-chloro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid |
| SMILES | CCC(NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H14ClNO6S2/c1-3-9(11(14)15)13-21(18,19)10-6-7(20(2,16)17)4-5-8(10)12/h4-6,9,13H,3H2,1-2H3,(H,14,15) |
| InChIKey | CPRIIOQZMFQWRP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |