C10H14N2O4S — CID 71945727
2-[(4-aminophenyl)sulfonylamino]butanoic acid (PubChem CID 71945727) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-[(4-aminophenyl)sulfonylamino]butanoic acid.
| Compound Name | 2-[(4-aminophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 71945727 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[(4-aminophenyl)sulfonylamino]butanoic acid |
| SMILES | CCC(NS(=O)(=O)c1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C10H14N2O4S/c1-2-9(10(13)14)12-17(15,16)8-5-3-7(11)4-6-8/h3-6,9,12H,2,11H2,1H3,(H,13,14) |
| InChIKey | NNXYSPBNGPWHPT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|