C13H18N2O5S — CID 43386785
2-[[4-(acetamidomethyl)phenyl]sulfonylamino]butanoic acid (PubChem CID 43386785) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-[[4-(acetamidomethyl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 2-[[4-(acetamidomethyl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43386785 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[[4-(acetamidomethyl)phenyl]sulfonylamino]butanoic acid |
| SMILES | CCC(NS(=O)(=O)c1ccc(CNC(C)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H18N2O5S/c1-3-12(13(17)18)15-21(19,20)11-6-4-10(5-7-11)8-14-9(2)16/h4-7,12,15H,3,8H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | LAXPFRCJRHYFCE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |