C14H21NO4S — CID 42255460
(2S)-2-[(4-tert-butylphenyl)sulfonylamino]butanoic acid (PubChem CID 42255460) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (2S)-2-[(4-tert-butylphenyl)sulfonylamino]butanoic acid.
| Compound Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 42255460 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]butanoic acid |
| SMILES | CC[C@H](NS(=O)(=O)c1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C14H21NO4S/c1-5-12(13(16)17)15-20(18,19)11-8-6-10(7-9-11)14(2,3)4/h6-9,12,15H,5H2,1-4H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | HQGQBOMAMFWRCM-LBPRGKRZSA-N |
| XLogP | 2.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |