C11H11BrClNO4S — CID 106605598
2-[(3-bromo-4-chlorophenyl)sulfonylamino]pent-4-enoic acid (PubChem CID 106605598) has the molecular formula C11H11BrClNO4S and a molecular weight of 368.64 g/mol. Its IUPAC name is 2-[(3-bromo-4-chlorophenyl)sulfonylamino]pent-4-enoic acid.
| Compound Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 106605598 |
| Molecular Formula | C11H11BrClNO4S |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 366.93 |
| IUPAC Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]pent-4-enoic acid |
| SMILES | C=CCC(NS(=O)(=O)c1ccc(Cl)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C11H11BrClNO4S/c1-2-3-10(11(15)16)14-19(17,18)7-4-5-9(13)8(12)6-7/h2,4-6,10,14H,1,3H2,(H,15,16) |
| InChIKey | KITICZLPYXETGL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|