C34H49NO10S — CID 89120215
ditert-butyl (4S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 89120215) has the molecular formula C34H49NO10S and a molecular weight of 663.83 g/mol. Its IUPAC name is ditert-butyl (4S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | ditert-butyl (4S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 89120215 |
| Molecular Formula | C34H49NO10S |
| Molecular Weight | 663.83 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | ditert-butyl (4S)-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(CC(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H49NO10S/c1-23-11-17-27(18-12-23)46(39,40)42-20-19-41-26-15-13-24(14-16-26)21-25(29(36)43-32(2,3)4)22-28(30(37)44-33(5,6)7)35-31(38)45-34(8,9)10/h11-18,25,28H,19-22H2,1-10H3,(H,35,38)/t25?,28-/m0/s1 |
| InChIKey | GONCXYMVIJOPRF-NMXAJACMSA-N |
| XLogP | 5.90 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.83 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|