C36H56O14S — CID 166148498
tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 166148498) has the molecular formula C36H56O14S and a molecular weight of 744.90 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 166148498 |
| Molecular Formula | C36H56O14S |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.34 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOc2ccc(C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H56O14S/c1-31-5-11-34(12-6-31)51(38,39)49-30-28-47-26-24-45-22-20-43-18-16-41-14-13-40-15-17-42-19-21-44-23-25-46-27-29-48-33-9-7-32(8-10-33)35(37)50-36(2,3)4/h5-12H,13-30H2,1-4H3 |
| InChIKey | IZRGEJXKIOPBKD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 152.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|