C21H27NO7S — CID 126511568
methyl 4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylamino]benzoate (PubChem CID 126511568) has the molecular formula C21H27NO7S and a molecular weight of 437.51 g/mol. Its IUPAC name is methyl 4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylamino]benzoate.
| Compound Name | methyl 4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylamino]benzoate |
|---|---|
| PubChem CID | 126511568 |
| Molecular Formula | C21H27NO7S |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | methyl 4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCCOCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H27NO7S/c1-17-3-9-20(10-4-17)30(24,25)29-16-15-28-14-13-27-12-11-22-19-7-5-18(6-8-19)21(23)26-2/h3-10,22H,11-16H2,1-2H3 |
| InChIKey | XIHCDSIUPNAZAZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|