C21H35NO8S — CID 135368538
2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 135368538) has the molecular formula C21H35NO8S and a molecular weight of 461.58 g/mol. Its IUPAC name is 2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135368538 |
| Molecular Formula | C21H35NO8S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCN(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H35NO8S/c1-18-6-8-19(9-7-18)31(24,25)29-17-16-28-15-14-27-13-12-26-11-10-22(5)20(23)30-21(2,3)4/h6-9H,10-17H2,1-5H3 |
| InChIKey | BIGXRUYQZACYCX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|