C17H25F2NO5S — CID 168947786
[3,3-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl] 4-methylbenzenesulfonate (PubChem CID 168947786) has the molecular formula C17H25F2NO5S and a molecular weight of 393.45 g/mol. Its IUPAC name is [3,3-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl] 4-methylbenzenesulfonate.
| Compound Name | [3,3-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168947786 |
| Molecular Formula | C17H25F2NO5S |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [3,3-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(F)(F)CN(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25F2NO5S/c1-13-6-8-14(9-7-13)26(22,23)24-11-10-17(18,19)12-20(5)15(21)25-16(2,3)4/h6-9H,10-12H2,1-5H3 |
| InChIKey | CYCSKVQEESJBBY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|