About tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate
tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate (PubChem CID 172915689) has the molecular formula C10H19F2NO3
and a molecular weight of 239.26 g/mol. Its IUPAC name is tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate.
Analyze tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate?
The IUPAC name of tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate (CID 172915689) is tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate?
The canonical SMILES for tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate is CN(CC(F)(F)CCO)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate?
The InChIKey is RNRUJMVJAINFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO3/c1-9(2,3)16-8(15)13(4)7-10(11,12)5-6-14/h14H,5-7H2,1-4H3.
What are the key properties of tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate?
tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate has a molecular weight of 239.26 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2,2-difluoro-4-hydroxybutyl)-N-methylcarbamate is sourced from PubChem (CID 172915689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).