C10H21NO3 — CID 91279128
tert-butyl N-(3-hydroxy-2-methylpropyl)-N-methylcarbamate (PubChem CID 91279128) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is tert-butyl N-(3-hydroxy-2-methylpropyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(3-hydroxy-2-methylpropyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 91279128 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | tert-butyl N-(3-hydroxy-2-methylpropyl)-N-methylcarbamate |
| SMILES | CC(CO)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-8(7-12)6-11(5)9(13)14-10(2,3)4/h8,12H,6-7H2,1-5H3 |
| InChIKey | ANPGGENQQSVXSP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |