C12H25NO7 — CID 13034825
tert-butyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate (PubChem CID 13034825) has the molecular formula C12H25NO7 and a molecular weight of 295.33 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate |
|---|---|
| PubChem CID | 13034825 |
| Molecular Formula | C12H25NO7 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate |
| SMILES | CN(CC(O)C(O)C(O)C(O)CO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO7/c1-12(2,3)20-11(19)13(4)5-7(15)9(17)10(18)8(16)6-14/h7-10,14-18H,5-6H2,1-4H3 |
| InChIKey | NNTYBRYFSJTNOS-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |