C10H18FNO4 — CID 105495939
2-(fluoromethyl)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (PubChem CID 105495939) has the molecular formula C10H18FNO4 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-(fluoromethyl)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid.
| Compound Name | 2-(fluoromethyl)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 105495939 |
| Molecular Formula | C10H18FNO4 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(fluoromethyl)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| SMILES | CN(CC(CF)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18FNO4/c1-10(2,3)16-9(15)12(4)6-7(5-11)8(13)14/h7H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | XSYPINLTRDWDCH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |