C19H30O7S — CID 126619968
tert-butyl 2-[3-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]acetate (PubChem CID 126619968) has the molecular formula C19H30O7S and a molecular weight of 402.51 g/mol. Its IUPAC name is tert-butyl 2-[3-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]acetate.
| Compound Name | tert-butyl 2-[3-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]acetate |
|---|---|
| PubChem CID | 126619968 |
| Molecular Formula | C19H30O7S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | tert-butyl 2-[3-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]acetate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCOCCCOCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30O7S/c1-16-7-9-17(10-8-16)27(21,22)25-14-6-12-23-11-5-13-24-15-18(20)26-19(2,3)4/h7-10H,5-6,11-15H2,1-4H3 |
| InChIKey | GYUQXZQRFQLKBB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|