C18H28O6S — CID 166524692
tert-butyl 3-[4-(4-methylphenyl)sulfonyloxybutoxy]propanoate (PubChem CID 166524692) has the molecular formula C18H28O6S and a molecular weight of 372.48 g/mol. Its IUPAC name is tert-butyl 3-[4-(4-methylphenyl)sulfonyloxybutoxy]propanoate.
| Compound Name | tert-butyl 3-[4-(4-methylphenyl)sulfonyloxybutoxy]propanoate |
|---|---|
| PubChem CID | 166524692 |
| Molecular Formula | C18H28O6S |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | tert-butyl 3-[4-(4-methylphenyl)sulfonyloxybutoxy]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCOCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O6S/c1-15-7-9-16(10-8-15)25(20,21)23-13-6-5-12-22-14-11-17(19)24-18(2,3)4/h7-10H,5-6,11-14H2,1-4H3 |
| InChIKey | FUNMDBJURQMGOL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|