C20H32O6S — CID 166524623
tert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonyloxypentoxy]propanoate (PubChem CID 166524623) has the molecular formula C20H32O6S and a molecular weight of 400.54 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonyloxypentoxy]propanoate.
| Compound Name | tert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonyloxypentoxy]propanoate |
|---|---|
| PubChem CID | 166524623 |
| Molecular Formula | C20H32O6S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | tert-butyl 2-methyl-2-[5-(4-methylphenyl)sulfonyloxypentoxy]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCOC(C)(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32O6S/c1-16-10-12-17(13-11-16)27(22,23)25-15-9-7-8-14-24-20(5,6)18(21)26-19(2,3)4/h10-13H,7-9,14-15H2,1-6H3 |
| InChIKey | OACBLJGMIDXTJW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|