C31H37N3O7S — CID 162502732
2-[2-[4-[(E)-[(E)-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]methylidenehydrazinylidene]methyl]phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 162502732) has the molecular formula C31H37N3O7S and a molecular weight of 595.72 g/mol. Its IUPAC name is 2-[2-[4-[(E)-[(E)-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]methylidenehydrazinylidene]methyl]phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[4-[(E)-[(E)-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]methylidenehydrazinylidene]methyl]phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162502732 |
| Molecular Formula | C31H37N3O7S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 2-[2-[4-[(E)-[(E)-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]methylidenehydrazinylidene]methyl]phenoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOc2ccc(/C=N/N=C/c3ccc(N(C)C(=O)OC(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O7S/c1-24-6-16-29(17-7-24)42(36,37)40-21-19-38-18-20-39-28-14-10-26(11-15-28)23-33-32-22-25-8-12-27(13-9-25)34(5)30(35)41-31(2,3)4/h6-17,22-23H,18-21H2,1-5H3/b32-22+,33-23+ |
| InChIKey | GUWUELXRNIEFAX-VDTYKYKFSA-N |
| XLogP | 5.62 |
| TPSA | 116.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|