C33H41NO8S — CID 123260250
4-methyl-2-[2-[2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid (PubChem CID 123260250) has the molecular formula C33H41NO8S and a molecular weight of 611.76 g/mol. Its IUPAC name is 4-methyl-2-[2-[2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-[2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 123260250 |
| Molecular Formula | C33H41NO8S |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 4-methyl-2-[2-[2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOCCOCCOc2ccc(C=Cc3ccc(N(C)C(=O)OC(C)(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C33H41NO8S/c1-25-6-17-31(43(36,37)38)28(24-25)18-19-39-20-21-40-22-23-41-30-15-11-27(12-16-30)8-7-26-9-13-29(14-10-26)34(5)32(35)42-33(2,3)4/h6-17,24H,18-23H2,1-5H3,(H,36,37,38) |
| InChIKey | XCZYZPCSNPDQOO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|