C31H36N2O8S — CID 130408684
4-methyl-2-[2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl]benzenesulfonic acid (PubChem CID 130408684) has the molecular formula C31H36N2O8S and a molecular weight of 596.70 g/mol. Its IUPAC name is 4-methyl-2-[2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 130408684 |
| Molecular Formula | C31H36N2O8S |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 4-methyl-2-[2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl]benzenesulfonic acid |
| SMILES | CCCN(C(=O)OC(C)(C)C)c1ccc(/C=C/c2ccc([N+](=O)[O-])c(OCCc3cc(C)ccc3S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C31H36N2O8S/c1-6-18-32(30(34)41-31(3,4)5)26-13-10-23(11-14-26)8-9-24-12-15-27(33(35)36)28(21-24)40-19-17-25-20-22(2)7-16-29(25)42(37,38)39/h7-16,20-21H,6,17-19H2,1-5H3,(H,37,38,39)/b9-8+ |
| InChIKey | KQVJVRCFOQWPRV-CMDGGOBGSA-N |
| XLogP | 7.09 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|