C31H36N2O8S — CID 130408391
2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 130408391) has the molecular formula C31H36N2O8S and a molecular weight of 596.70 g/mol. Its IUPAC name is 2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 130408391 |
| Molecular Formula | C31H36N2O8S |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2-[5-[(E)-2-[4-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]phenyl]ethenyl]-2-nitrophenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2cc(/C=C/c3ccc(N(C(=O)OC(C)(C)C)C(C)C)cc3)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H36N2O8S/c1-22(2)32(30(34)41-31(4,5)6)26-14-11-24(12-15-26)9-10-25-13-18-28(33(35)36)29(21-25)39-19-20-40-42(37,38)27-16-7-23(3)8-17-27/h7-18,21-22H,19-20H2,1-6H3/b10-9+ |
| InChIKey | BNKGRZCIVQOGAB-MDZDMXLPSA-N |
| XLogP | 7.01 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|