C24H26N2O4S — CID 59217428
2-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]oxy]ethyl 4-methylbenzenesulfonate (PubChem CID 59217428) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]oxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]oxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59217428 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2-pyridinyl]oxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(/C=C/c3ccc(N(C)C)cc3)cn2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-19-4-13-23(14-5-19)31(27,28)30-17-16-29-24-15-10-21(18-25-24)7-6-20-8-11-22(12-9-20)26(2)3/h4-15,18H,16-17H2,1-3H3/b7-6+ |
| InChIKey | VNCWYBSBKMUHOK-VOTSOKGWSA-N |
| XLogP | 4.41 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|