C33H32O6S — CID 11656939
2-[2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 11656939) has the molecular formula C33H32O6S and a molecular weight of 556.68 g/mol. Its IUPAC name is 2-[2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11656939 |
| Molecular Formula | C33H32O6S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-[2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/C=C/c2ccc(/C=C/c3ccc(OC)cc3)c(OCCOS(=O)(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C33H32O6S/c1-25-4-20-32(21-5-25)40(34,35)39-23-22-38-33-24-28(7-6-26-10-16-30(36-2)17-11-26)9-15-29(33)14-8-27-12-18-31(37-3)19-13-27/h4-21,24H,22-23H2,1-3H3/b7-6+,14-8+ |
| InChIKey | LBWXYUCUTAYVLL-MDVYSFJGSA-N |
| XLogP | 7.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|