C16H20O9S2 — CID 158521321
2-(4-methoxyphenoxy)sulfonyloxyethyl 4-methylbenzenesulfonate;hydrate (PubChem CID 158521321) has the molecular formula C16H20O9S2 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)sulfonyloxyethyl 4-methylbenzenesulfonate;hydrate.
| Compound Name | 2-(4-methoxyphenoxy)sulfonyloxyethyl 4-methylbenzenesulfonate;hydrate |
|---|---|
| PubChem CID | 158521321 |
| Molecular Formula | C16H20O9S2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-(4-methoxyphenoxy)sulfonyloxyethyl 4-methylbenzenesulfonate;hydrate |
| SMILES | COc1ccc(OS(=O)(=O)OCCOS(=O)(=O)c2ccc(C)cc2)cc1.O |
| InChI | InChI=1S/C16H18O8S2.H2O/c1-13-3-9-16(10-4-13)25(17,18)22-11-12-23-26(19,20)24-15-7-5-14(21-2)6-8-15;/h3-10H,11-12H2,1-2H3;1H2 |
| InChIKey | JNOCYNCKKFBVSG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 136.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|