C13H20O6S — CID 156866600
2-(2,2-dimethoxyethoxy)ethyl 4-methylbenzenesulfonate (PubChem CID 156866600) has the molecular formula C13H20O6S and a molecular weight of 304.36 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethoxy)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2,2-dimethoxyethoxy)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 156866600 |
| Molecular Formula | C13H20O6S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-(2,2-dimethoxyethoxy)ethyl 4-methylbenzenesulfonate |
| SMILES | COC(COCCOS(=O)(=O)c1ccc(C)cc1)OC |
| InChI | InChI=1S/C13H20O6S/c1-11-4-6-12(7-5-11)20(14,15)19-9-8-18-10-13(16-2)17-3/h4-7,13H,8-10H2,1-3H3 |
| InChIKey | JXKQNDYXYFDEHS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|