C28H34O8S2 — CID 15150266
2-[2-benzyl-3-[2-(4-methylphenyl)sulfonyloxyethoxy]propoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 15150266) has the molecular formula C28H34O8S2 and a molecular weight of 562.71 g/mol. Its IUPAC name is 2-[2-benzyl-3-[2-(4-methylphenyl)sulfonyloxyethoxy]propoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-benzyl-3-[2-(4-methylphenyl)sulfonyloxyethoxy]propoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15150266 |
| Molecular Formula | C28H34O8S2 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 2-[2-benzyl-3-[2-(4-methylphenyl)sulfonyloxyethoxy]propoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCC(COCCOS(=O)(=O)c2ccc(C)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H34O8S2/c1-23-8-12-27(13-9-23)37(29,30)35-18-16-33-21-26(20-25-6-4-3-5-7-25)22-34-17-19-36-38(31,32)28-14-10-24(2)11-15-28/h3-15,26H,16-22H2,1-2H3 |
| InChIKey | ROQSVDRSCMTRTJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|