C42H36N2O8S2 — CID 100930715
2-[4-[9-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 100930715) has the molecular formula C42H36N2O8S2 and a molecular weight of 760.89 g/mol. Its IUPAC name is 2-[4-[9-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[9-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 100930715 |
| Molecular Formula | C42H36N2O8S2 |
| Molecular Weight | 760.89 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | 2-[4-[9-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(-c3ccc4ccc5ccc(-c6ccc(OCCOS(=O)(=O)c7ccc(C)cc7)cc6)nc5c4n3)cc2)cc1 |
| InChI | InChI=1S/C42H36N2O8S2/c1-29-3-19-37(20-4-29)53(45,46)51-27-25-49-35-15-9-31(10-16-35)39-23-13-33-7-8-34-14-24-40(44-42(34)41(33)43-39)32-11-17-36(18-12-32)50-26-28-52-54(47,48)38-21-5-30(2)6-22-38/h3-24H,25-28H2,1-2H3 |
| InChIKey | OWCMVNPAOBPRNG-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.89 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|