C32H32N2O4 — CID 100930714
4-[4-[9-[4-(4-hydroxybutoxy)phenyl]-1,10-phenanthrolin-2-yl]phenoxy]butan-1-ol (PubChem CID 100930714) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 4-[4-[9-[4-(4-hydroxybutoxy)phenyl]-1,10-phenanthrolin-2-yl]phenoxy]butan-1-ol.
| Compound Name | 4-[4-[9-[4-(4-hydroxybutoxy)phenyl]-1,10-phenanthrolin-2-yl]phenoxy]butan-1-ol |
|---|---|
| PubChem CID | 100930714 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 4-[4-[9-[4-(4-hydroxybutoxy)phenyl]-1,10-phenanthrolin-2-yl]phenoxy]butan-1-ol |
| SMILES | OCCCCOc1ccc(-c2ccc3ccc4ccc(-c5ccc(OCCCCO)cc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C32H32N2O4/c35-19-1-3-21-37-27-13-7-23(8-14-27)29-17-11-25-5-6-26-12-18-30(34-32(26)31(25)33-29)24-9-15-28(16-10-24)38-22-4-2-20-36/h5-18,35-36H,1-4,19-22H2 |
| InChIKey | OXTNFKFTKFNPJY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|