C32H32N2O6 — CID 102331818
2-[2-[4-[9-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethoxy]ethanol (PubChem CID 102331818) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2-[2-[4-[9-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[9-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 102331818 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[2-[4-[9-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-1,10-phenanthrolin-2-yl]phenoxy]ethoxy]ethanol |
| SMILES | OCCOCCOc1ccc(-c2ccc3ccc4ccc(-c5ccc(OCCOCCO)cc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C32H32N2O6/c35-15-17-37-19-21-39-27-9-3-23(4-10-27)29-13-7-25-1-2-26-8-14-30(34-32(26)31(25)33-29)24-5-11-28(12-6-24)40-22-20-38-18-16-36/h1-14,35-36H,15-22H2 |
| InChIKey | DABOVXQTORBEAC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|