About 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten
4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten (PubChem CID 58924724) has the molecular formula C10H14O4W9
and a molecular weight of 1852.78 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten.
Molecular Properties
| Compound Name | 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten |
| PubChem CID | 58924724 |
| Molecular Formula | C10H14O4W9 |
| Molecular Weight | 1852.78 g/mol |
| Exact Mass | 1853.65 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten |
| SMILES | OCCOCCOc1ccc(O)cc1.[W].[W].[W].[W].[W].[W].[W].[W].[W] |
| InChI | InChI=1S/C10H14O4.9W/c11-5-6-13-7-8-14-10-3-1-9(12)2-4-10;;;;;;;;;/h1-4,11-12H,5-8H2;;;;;;;;; |
| InChIKey | IVTIEIZNUHHORU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1852.78 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten?
The IUPAC name of 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten (CID 58924724) is 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten.
What is the SMILES notation for 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten?
The canonical SMILES for 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten is OCCOCCOc1ccc(O)cc1.[W].[W].[W].[W].[W].[W].[W].[W].[W].
What is the InChIKey of 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten?
The InChIKey is IVTIEIZNUHHORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4.9W/c11-5-6-13-7-8-14-10-3-1-9(12)2-4-10;;;;;;;;;/h1-4,11-12H,5-8H2;;;;;;;;;.
What are the key properties of 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten?
4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten has a molecular weight of 1852.78 g/mol, XLogP of 0.76, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-hydroxyethoxy)ethoxy]phenol;tungsten is sourced from PubChem (CID 58924724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).