C44H48N2O7 — CID 58954213
2-[4-[2-[2-[2-[2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-8-(3-methylphenyl)-1,10-phenanthroline (PubChem CID 58954213) has the molecular formula C44H48N2O7 and a molecular weight of 716.87 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-[2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-8-(3-methylphenyl)-1,10-phenanthroline.
| Compound Name | 2-[4-[2-[2-[2-[2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-8-(3-methylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 58954213 |
| Molecular Formula | C44H48N2O7 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.35 |
| IUPAC Name | 2-[4-[2-[2-[2-[2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-8-(3-methylphenyl)-1,10-phenanthroline |
| SMILES | Cc1ccc(OCCOCCOCCOCCOCCOCCOc2ccc(-c3ccc4ccc5cc(-c6cccc(C)c6)cnc5c4n3)cc2)cc1 |
| InChI | InChI=1S/C44H48N2O7/c1-33-6-13-40(14-7-33)52-28-26-50-24-22-48-20-18-47-19-21-49-23-25-51-27-29-53-41-15-10-35(11-16-41)42-17-12-36-8-9-38-31-39(32-45-43(38)44(36)46-42)37-5-3-4-34(2)30-37/h3-17,30-32H,18-29H2,1-2H3 |
| InChIKey | NAPNAJJQZGWSOR-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|