C18H20INO6S — CID 90266326
2-amino-3-[2-iodo-5-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]propanoic acid (PubChem CID 90266326) has the molecular formula C18H20INO6S and a molecular weight of 505.33 g/mol. Its IUPAC name is 2-amino-3-[2-iodo-5-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-iodo-5-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 90266326 |
| Molecular Formula | C18H20INO6S |
| Molecular Weight | 505.33 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 2-amino-3-[2-iodo-5-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(I)c(CC(N)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H20INO6S/c1-12-2-5-15(6-3-12)27(23,24)26-9-8-25-14-4-7-16(19)13(10-14)11-17(20)18(21)22/h2-7,10,17H,8-9,11,20H2,1H3,(H,21,22) |
| InChIKey | WCKQKLITABGHKI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|