C19H22O6S — CID 170705288
ethyl 2-[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]acetate (PubChem CID 170705288) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl 2-[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]acetate.
| Compound Name | ethyl 2-[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 170705288 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | ethyl 2-[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(OCCOS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H22O6S/c1-3-23-19(20)14-16-5-4-6-17(13-16)24-11-12-25-26(21,22)18-9-7-15(2)8-10-18/h4-10,13H,3,11-12,14H2,1-2H3 |
| InChIKey | PRAXGCAHZIYEHH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|