C24H30N4O8S2 — CID 59552598
methyl (2S)-2-[[(2S)-2-azido-4-hydroxybutanoyl]amino]-3-[[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methylsulfanyl]propanoate (PubChem CID 59552598) has the molecular formula C24H30N4O8S2 and a molecular weight of 566.66 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-azido-4-hydroxybutanoyl]amino]-3-[[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methylsulfanyl]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-azido-4-hydroxybutanoyl]amino]-3-[[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 59552598 |
| Molecular Formula | C24H30N4O8S2 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-azido-4-hydroxybutanoyl]amino]-3-[[3-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]methylsulfanyl]propanoate |
| SMILES | COC(=O)[C@@H](CSCc1cccc(OCCOS(=O)(=O)c2ccc(C)cc2)c1)NC(=O)[C@H](CCO)N=[N+]=[N-] |
| InChI | InChI=1S/C24H30N4O8S2/c1-17-6-8-20(9-7-17)38(32,33)36-13-12-35-19-5-3-4-18(14-19)15-37-16-22(24(31)34-2)26-23(30)21(10-11-29)27-28-25/h3-9,14,21-22,29H,10-13,15-16H2,1-2H3,(H,26,30)/t21-,22+/m0/s1 |
| InChIKey | CGIAEQVCQULDHB-FCHUYYIVSA-N |
| XLogP | 2.73 |
| TPSA | 176.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|