C14H20O6S — CID 135387471
methyl 2-ethoxy-4-(4-methylphenyl)sulfonyloxybutanoate (PubChem CID 135387471) has the molecular formula C14H20O6S and a molecular weight of 316.38 g/mol. Its IUPAC name is methyl 2-ethoxy-4-(4-methylphenyl)sulfonyloxybutanoate.
| Compound Name | methyl 2-ethoxy-4-(4-methylphenyl)sulfonyloxybutanoate |
|---|---|
| PubChem CID | 135387471 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | methyl 2-ethoxy-4-(4-methylphenyl)sulfonyloxybutanoate |
| SMILES | CCOC(CCOS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C14H20O6S/c1-4-19-13(14(15)18-3)9-10-20-21(16,17)12-7-5-11(2)6-8-12/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | BYWAIKQAPXTTQO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|