C20H24O8S2 — CID 22111759
methyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate (PubChem CID 22111759) has the molecular formula C20H24O8S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is methyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate.
| Compound Name | methyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate |
|---|---|
| PubChem CID | 22111759 |
| Molecular Formula | C20H24O8S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | methyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate |
| SMILES | COC(=O)C(CCCOS(=O)(=O)c1ccc(C)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H24O8S2/c1-15-6-10-17(11-7-15)29(22,23)27-14-4-5-19(20(21)26-3)28-30(24,25)18-12-8-16(2)9-13-18/h6-13,19H,4-5,14H2,1-3H3 |
| InChIKey | VNDZAXXGXAVWNZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|