C25H26O8S2 — CID 22111694
phenyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate (PubChem CID 22111694) has the molecular formula C25H26O8S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is phenyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate.
| Compound Name | phenyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate |
|---|---|
| PubChem CID | 22111694 |
| Molecular Formula | C25H26O8S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | phenyl 2,5-bis-(4-methylphenyl)sulfonyloxypentanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC(OS(=O)(=O)c2ccc(C)cc2)C(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26O8S2/c1-19-10-14-22(15-11-19)34(27,28)31-18-6-9-24(25(26)32-21-7-4-3-5-8-21)33-35(29,30)23-16-12-20(2)13-17-23/h3-5,7-8,10-17,24H,6,9,18H2,1-2H3 |
| InChIKey | QSLKUFCSJAJLQU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|