C16H16O8S2 — CID 57134132
2,4-bis(benzenesulfonyloxy)butanoic acid (PubChem CID 57134132) has the molecular formula C16H16O8S2 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2,4-bis(benzenesulfonyloxy)butanoic acid.
| Compound Name | 2,4-bis(benzenesulfonyloxy)butanoic acid |
|---|---|
| PubChem CID | 57134132 |
| Molecular Formula | C16H16O8S2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2,4-bis(benzenesulfonyloxy)butanoic acid |
| SMILES | O=C(O)C(CCOS(=O)(=O)c1ccccc1)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16O8S2/c17-16(18)15(24-26(21,22)14-9-5-2-6-10-14)11-12-23-25(19,20)13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,17,18) |
| InChIKey | UPMAECZHPQVJQE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|