C36H36O5P2S — CID 14592200
4,5-bis(diphenylphosphoryl)pentyl 4-methylbenzenesulfonate (PubChem CID 14592200) has the molecular formula C36H36O5P2S and a molecular weight of 642.69 g/mol. Its IUPAC name is 4,5-bis(diphenylphosphoryl)pentyl 4-methylbenzenesulfonate.
| Compound Name | 4,5-bis(diphenylphosphoryl)pentyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14592200 |
| Molecular Formula | C36H36O5P2S |
| Molecular Weight | 642.69 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | 4,5-bis(diphenylphosphoryl)pentyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC(CP(=O)(c2ccccc2)c2ccccc2)P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H36O5P2S/c1-30-24-26-36(27-25-30)44(39,40)41-28-14-23-35(43(38,33-19-10-4-11-20-33)34-21-12-5-13-22-34)29-42(37,31-15-6-2-7-16-31)32-17-8-3-9-18-32/h2-13,15-22,24-27,35H,14,23,28-29H2,1H3 |
| InChIKey | LRTFCIAEWJPJBW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.69 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|