C22H23O4PS — CID 10341723
3-diphenylphosphorylpropyl 4-methylbenzenesulfonate (PubChem CID 10341723) has the molecular formula C22H23O4PS and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-diphenylphosphorylpropyl 4-methylbenzenesulfonate.
| Compound Name | 3-diphenylphosphorylpropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10341723 |
| Molecular Formula | C22H23O4PS |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-diphenylphosphorylpropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23O4PS/c1-19-13-15-22(16-14-19)28(24,25)26-17-8-18-27(23,20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-16H,8,17-18H2,1H3 |
| InChIKey | BVUPLYBXAJNGKI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|