C29H28O4S — CID 24824425
3-trityloxypropyl 4-methylbenzenesulfonate (PubChem CID 24824425) has the molecular formula C29H28O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 3-trityloxypropyl 4-methylbenzenesulfonate.
| Compound Name | 3-trityloxypropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24824425 |
| Molecular Formula | C29H28O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-trityloxypropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H28O4S/c1-24-18-20-28(21-19-24)34(30,31)33-23-11-22-32-29(25-12-5-2-6-13-25,26-14-7-3-8-15-26)27-16-9-4-10-17-27/h2-10,12-21H,11,22-23H2,1H3 |
| InChIKey | LECSDGZSXJBSIQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|