C36H42O6S — CID 140899110
4-[3-(3-trityloxypropoxy)propoxy]butyl 4-methylbenzenesulfonate (PubChem CID 140899110) has the molecular formula C36H42O6S and a molecular weight of 602.79 g/mol. Its IUPAC name is 4-[3-(3-trityloxypropoxy)propoxy]butyl 4-methylbenzenesulfonate.
| Compound Name | 4-[3-(3-trityloxypropoxy)propoxy]butyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 140899110 |
| Molecular Formula | C36H42O6S |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 4-[3-(3-trityloxypropoxy)propoxy]butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCOCCCOCCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H42O6S/c1-31-21-23-35(24-22-31)43(37,38)42-30-12-11-25-39-26-13-27-40-28-14-29-41-36(32-15-5-2-6-16-32,33-17-7-3-8-18-33)34-19-9-4-10-20-34/h2-10,15-24H,11-14,25-30H2,1H3 |
| InChIKey | HDBCZJLJMPSHJE-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|