C37H37NO6S2 — CID 22495477
2-[2-(4-methylphenyl)sulfonyloxyethyl-tritylamino]ethyl 4-methylbenzenesulfonate (PubChem CID 22495477) has the molecular formula C37H37NO6S2 and a molecular weight of 655.84 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)sulfonyloxyethyl-tritylamino]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(4-methylphenyl)sulfonyloxyethyl-tritylamino]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22495477 |
| Molecular Formula | C37H37NO6S2 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | 2-[2-(4-methylphenyl)sulfonyloxyethyl-tritylamino]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCN(CCOS(=O)(=O)c2ccc(C)cc2)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H37NO6S2/c1-30-18-22-35(23-19-30)45(39,40)43-28-26-38(27-29-44-46(41,42)36-24-20-31(2)21-25-36)37(32-12-6-3-7-13-32,33-14-8-4-9-15-33)34-16-10-5-11-17-34/h3-25H,26-29H2,1-2H3 |
| InChIKey | VKCHVFIKPUMISS-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|