C18H22O5S — CID 88733247
(3-hydroxy-3-methyl-4-phenoxybutyl) 4-methylbenzenesulfonate (PubChem CID 88733247) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is (3-hydroxy-3-methyl-4-phenoxybutyl) 4-methylbenzenesulfonate.
| Compound Name | (3-hydroxy-3-methyl-4-phenoxybutyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88733247 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (3-hydroxy-3-methyl-4-phenoxybutyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(C)(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22O5S/c1-15-8-10-17(11-9-15)24(20,21)23-13-12-18(2,19)14-22-16-6-4-3-5-7-16/h3-11,19H,12-14H2,1-2H3 |
| InChIKey | FBHPZVQETURRDQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|