C14H15NO4S — CID 144959689
2-pyridin-3-yloxyethyl 4-methylbenzenesulfonate (PubChem CID 144959689) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-pyridin-3-yloxyethyl 4-methylbenzenesulfonate.
| Compound Name | 2-pyridin-3-yloxyethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 144959689 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-pyridin-3-yloxyethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2cccnc2)cc1 |
| InChI | InChI=1S/C14H15NO4S/c1-12-4-6-14(7-5-12)20(16,17)19-10-9-18-13-3-2-8-15-11-13/h2-8,11H,9-10H2,1H3 |
| InChIKey | GKOJIFQENJSVBV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|